C19H26N2O4S — CID 14307710
(1S,16R,21S)-20-methylsulfonyl-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene (PubChem CID 14307710) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is (1S,16R,21S)-20-methylsulfonyl-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene.
| Compound Name | (1S,16R,21S)-20-methylsulfonyl-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene |
|---|---|
| PubChem CID | 14307710 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (1S,16R,21S)-20-methylsulfonyl-5,8-dioxa-14,20-diazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4(9),10-triene |
| SMILES | CS(=O)(=O)N1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCCO5 |
| InChI | InChI=1S/C19H26N2O4S/c1-26(22,23)21-5-2-3-14-12-20-6-4-13-9-18-19(25-8-7-24-18)10-15(13)17(20)11-16(14)21/h9-10,14,16-17H,2-8,11-12H2,1H3/t14-,16+,17+/m1/s1 |
| InChIKey | YKECYCRAJYZOSV-PVAVHDDUSA-N |
| XLogP | 1.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |