C22H34N6O3S4 — CID 143077211
2-N'-[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]-1-N'-[5-(4-ethylpiperazin-1-yl)sulfonyl-4-hydroxythiophen-3-yl]-2-N-sulfanylethanediimidamide (PubChem CID 143077211) has the molecular formula C22H34N6O3S4 and a molecular weight of 558.82 g/mol. Its IUPAC name is 2-N'-[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]-1-N'-[5-(4-ethylpiperazin-1-yl)sulfonyl-4-hydroxythiophen-3-yl]-2-N-sulfanylethanediimidamide.
| Compound Name | 2-N'-[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]-1-N'-[5-(4-ethylpiperazin-1-yl)sulfonyl-4-hydroxythiophen-3-yl]-2-N-sulfanylethanediimidamide |
|---|---|
| PubChem CID | 143077211 |
| Molecular Formula | C22H34N6O3S4 |
| Molecular Weight | 558.82 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 2-N'-[(1R)-1-(4,5-dimethylthiophen-2-yl)-2-methylpropyl]-1-N'-[5-(4-ethylpiperazin-1-yl)sulfonyl-4-hydroxythiophen-3-yl]-2-N-sulfanylethanediimidamide |
| SMILES | CCN1CCN(S(=O)(=O)c2scc(/N=C(N)/C(=N/[C@@H](c3cc(C)c(C)s3)C(C)C)NS)c2O)CC1 |
| InChI | InChI=1S/C22H34N6O3S4/c1-6-27-7-9-28(10-8-27)35(30,31)22-19(29)16(12-33-22)24-20(23)21(26-32)25-18(13(2)3)17-11-14(4)15(5)34-17/h11-13,18,29,32H,6-10H2,1-5H3,(H2,23,24)(H,25,26)/t18-/m1/s1 |
| InChIKey | AZQPZBWXROQNMR-GOSISDBHSA-N |
| XLogP | 3.68 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|