C22H25ClN2O2S — CID 14307728
(8aR,12aS,13aS)-12-(4-chlorophenyl)sulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 14307728) has the molecular formula C22H25ClN2O2S and a molecular weight of 416.97 g/mol. Its IUPAC name is (8aR,12aS,13aS)-12-(4-chlorophenyl)sulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aR,12aS,13aS)-12-(4-chlorophenyl)sulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 14307728 |
| Molecular Formula | C22H25ClN2O2S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (8aR,12aS,13aS)-12-(4-chlorophenyl)sulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCC[C@@H]2CN3CCc4ccccc4[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C22H25ClN2O2S/c23-18-7-9-19(10-8-18)28(26,27)25-12-3-5-17-15-24-13-11-16-4-1-2-6-20(16)22(24)14-21(17)25/h1-2,4,6-10,17,21-22H,3,5,11-15H2/t17-,21+,22+/m1/s1 |
| InChIKey | FNCKBGUFFRPQSH-WTNAPCKOSA-N |
| XLogP | 4.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |