C19H24N5O3PS — CID 143077342
3-[[4-[[(4,5-dimethylfuran-2-yl)-ethylphosphanyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,6-dimethylbenzamide (PubChem CID 143077342) has the molecular formula C19H24N5O3PS and a molecular weight of 433.47 g/mol. Its IUPAC name is 3-[[4-[[(4,5-dimethylfuran-2-yl)-ethylphosphanyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,6-dimethylbenzamide.
| Compound Name | 3-[[4-[[(4,5-dimethylfuran-2-yl)-ethylphosphanyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,6-dimethylbenzamide |
|---|---|
| PubChem CID | 143077342 |
| Molecular Formula | C19H24N5O3PS |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 3-[[4-[[(4,5-dimethylfuran-2-yl)-ethylphosphanyl]amino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,6-dimethylbenzamide |
| SMILES | CCP(Nc1nsnc1Nc1ccc(C)c(C(=O)NC)c1O)c1cc(C)c(C)o1 |
| InChI | InChI=1S/C19H24N5O3PS/c1-6-28(14-9-11(3)12(4)27-14)22-18-17(23-29-24-18)21-13-8-7-10(2)15(16(13)25)19(26)20-5/h7-9,25H,6H2,1-5H3,(H,20,26)(H,21,23)(H,22,24) |
| InChIKey | KGWKRFLDMIYDHN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|