C22H27N3O2S — CID 14307746
4-[[(8aR,12aS,13aS)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]aniline (PubChem CID 14307746) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 4-[[(8aR,12aS,13aS)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]aniline.
| Compound Name | 4-[[(8aR,12aS,13aS)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]aniline |
|---|---|
| PubChem CID | 14307746 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-[[(8aR,12aS,13aS)-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]aniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCC[C@@H]3CN4CCc5ccccc5[C@@H]4C[C@@H]32)cc1 |
| InChI | InChI=1S/C22H27N3O2S/c23-18-7-9-19(10-8-18)28(26,27)25-12-3-5-17-15-24-13-11-16-4-1-2-6-20(16)22(24)14-21(17)25/h1-2,4,6-10,17,21-22H,3,5,11-15,23H2/t17-,21+,22+/m1/s1 |
| InChIKey | FMNMOQZEMJROGO-WTNAPCKOSA-N |
| XLogP | 3.04 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|