C13H17NOS — CID 143077703
(NE)-N-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethylidene]hydroxylamine (PubChem CID 143077703) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is (NE)-N-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 143077703 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (NE)-N-[1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C13H17NOS/c1-9(14-15)10-4-5-12-11(8-10)13(2,3)6-7-16-12/h4-5,8,15H,6-7H2,1-3H3/b14-9+ |
| InChIKey | HRNADLKHSCFUNO-NTEUORMPSA-N |
| XLogP | 3.66 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|