C33H40N2O3S — CID 14307786
(8S,10S,13S,14S,17R)-17-[2-[4-(1-benzothiophen-2-yl)piperazin-1-yl]acetyl]-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 14307786) has the molecular formula C33H40N2O3S and a molecular weight of 544.76 g/mol. Its IUPAC name is (8S,10S,13S,14S,17R)-17-[2-[4-(1-benzothiophen-2-yl)piperazin-1-yl]acetyl]-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17R)-17-[2-[4-(1-benzothiophen-2-yl)piperazin-1-yl]acetyl]-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 14307786 |
| Molecular Formula | C33H40N2O3S |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | (8S,10S,13S,14S,17R)-17-[2-[4-(1-benzothiophen-2-yl)piperazin-1-yl]acetyl]-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=CC[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CN1CCN(c2cc3ccccc3s2)CC1 |
| InChI | InChI=1S/C33H40N2O3S/c1-31-12-9-24(36)20-23(31)7-8-25-26(31)10-13-32(2)27(25)11-14-33(32,38)29(37)21-34-15-17-35(18-16-34)30-19-22-5-3-4-6-28(22)39-30/h3-6,10,19-20,25,27,38H,7-9,11-18,21H2,1-2H3/t25-,27+,31+,32+,33+/m1/s1 |
| InChIKey | JKOQYTOOVGDWSE-HJFXQWBISA-N |
| XLogP | 5.78 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|