C20H29N3O — CID 143077914
3-ethyl-2-[(1E,5Z)-nona-1,5-dienyl]-6-propoxyimidazo[1,2-b]pyridazine (PubChem CID 143077914) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-ethyl-2-[(1E,5Z)-nona-1,5-dienyl]-6-propoxyimidazo[1,2-b]pyridazine.
| Compound Name | 3-ethyl-2-[(1E,5Z)-nona-1,5-dienyl]-6-propoxyimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 143077914 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 3-ethyl-2-[(1E,5Z)-nona-1,5-dienyl]-6-propoxyimidazo[1,2-b]pyridazine |
| SMILES | CCC/C=C\CC/C=C/c1nc2ccc(OCCC)nn2c1CC |
| InChI | InChI=1S/C20H29N3O/c1-4-7-8-9-10-11-12-13-17-18(6-3)23-19(21-17)14-15-20(22-23)24-16-5-2/h8-9,12-15H,4-7,10-11,16H2,1-3H3/b9-8-,13-12+ |
| InChIKey | XZZBZHJKWQQMLH-YILALFFRSA-N |
| XLogP | 5.23 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|