C27H37N10O2+ — CID 143078397
(Z)-[amino-[[(2R,5S)-4-[[3-[2-[3-(4-hydroxyphenyl)propylamino]pyrimidin-4-yl]phenyl]methyl]-5-methylpiperazine-2-carbonyl]amino]methyl]-hydrazinylideneazanium (PubChem CID 143078397) has the molecular formula C27H37N10O2+ and a molecular weight of 533.66 g/mol. Its IUPAC name is (Z)-[amino-[[(2R,5S)-4-[[3-[2-[3-(4-hydroxyphenyl)propylamino]pyrimidin-4-yl]phenyl]methyl]-5-methylpiperazine-2-carbonyl]amino]methyl]-hydrazinylideneazanium.
| Compound Name | (Z)-[amino-[[(2R,5S)-4-[[3-[2-[3-(4-hydroxyphenyl)propylamino]pyrimidin-4-yl]phenyl]methyl]-5-methylpiperazine-2-carbonyl]amino]methyl]-hydrazinylideneazanium |
|---|---|
| PubChem CID | 143078397 |
| Molecular Formula | C27H37N10O2+ |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | (Z)-[amino-[[(2R,5S)-4-[[3-[2-[3-(4-hydroxyphenyl)propylamino]pyrimidin-4-yl]phenyl]methyl]-5-methylpiperazine-2-carbonyl]amino]methyl]-hydrazinylideneazanium |
| SMILES | C[C@H]1CN[C@@H](C(=O)NC(N)/[NH+]=N\N)CN1Cc1cccc(-c2ccnc(NCCCc3ccc(O)cc3)n2)c1 |
| InChI | InChI=1S/C27H36N10O2/c1-18-15-32-24(25(39)34-26(28)35-36-29)17-37(18)16-20-4-2-6-21(14-20)23-11-13-31-27(33-23)30-12-3-5-19-7-9-22(38)10-8-19/h2,4,6-11,13-14,18,24,26,32,38H,3,5,12,15-17,28H2,1H3,(H2,29,35)(H,34,39)(H,30,31,33)/p+1/t18-,24+,26?/m0/s1 |
| InChIKey | HIWRVXHFMUMAPC-SWXGMBTRSA-O |
| XLogP | -0.18 |
| TPSA | 180.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|