C10H12N2O4 — CID 143078871
3,7,7-trimethyl-2,4-dinitrocyclohepta-1,3,5-triene (PubChem CID 143078871) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 3,7,7-trimethyl-2,4-dinitrocyclohepta-1,3,5-triene.
| Compound Name | 3,7,7-trimethyl-2,4-dinitrocyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143078871 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3,7,7-trimethyl-2,4-dinitrocyclohepta-1,3,5-triene |
| SMILES | CC1=C([N+](=O)[O-])C=CC(C)(C)C=C1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O4/c1-7-8(11(13)14)4-5-10(2,3)6-9(7)12(15)16/h4-6H,1-3H3 |
| InChIKey | AQKVOYKGWCMWNZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|