C20H25F3N4O2 — CID 143078945
2-[2-[[3-amino-5-methoxy-4-(propylamino)-2-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide (PubChem CID 143078945) has the molecular formula C20H25F3N4O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-[2-[[3-amino-5-methoxy-4-(propylamino)-2-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide.
| Compound Name | 2-[2-[[3-amino-5-methoxy-4-(propylamino)-2-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 143078945 |
| Molecular Formula | C20H25F3N4O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[2-[[3-amino-5-methoxy-4-(propylamino)-2-(trifluoromethyl)phenyl]methylamino]phenyl]acetamide |
| SMILES | CCCNc1c(OC)cc(CNc2ccccc2CC(N)=O)c(C(F)(F)F)c1N |
| InChI | InChI=1S/C20H25F3N4O2/c1-3-8-26-19-15(29-2)9-13(17(18(19)25)20(21,22)23)11-27-14-7-5-4-6-12(14)10-16(24)28/h4-7,9,26-27H,3,8,10-11,25H2,1-2H3,(H2,24,28) |
| InChIKey | OGVPYRUPSSYXLK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|