C24H36N3O3S+ — CID 143079093
ethane;hepta-1,3,6-trien-3-yl(oxo)azanium;[(E)-prop-1-enyl] N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidothioate (PubChem CID 143079093) has the molecular formula C24H36N3O3S+ and a molecular weight of 446.64 g/mol. Its IUPAC name is ethane;hepta-1,3,6-trien-3-yl(oxo)azanium;[(E)-prop-1-enyl] N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidothioate.
| Compound Name | ethane;hepta-1,3,6-trien-3-yl(oxo)azanium;[(E)-prop-1-enyl] N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidothioate |
|---|---|
| PubChem CID | 143079093 |
| Molecular Formula | C24H36N3O3S+ |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | ethane;hepta-1,3,6-trien-3-yl(oxo)azanium;[(E)-prop-1-enyl] N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidothioate |
| SMILES | C/C=C/S/C(=N\CC1COc2ccccc2O1)NCC.C=CCC=C(C=C)[NH+]=O.CC |
| InChI | InChI=1S/C15H20N2O2S.C7H9NO.C2H6/c1-3-9-20-15(16-4-2)17-10-12-11-18-13-7-5-6-8-14(13)19-12;1-3-5-6-7(4-2)8-9;1-2/h3,5-9,12H,4,10-11H2,1-2H3,(H,16,17);3-4,6H,1-2,5H2;1-2H3/p+1/b9-3+;; |
| InChIKey | YSIJNVGCKVOKJO-GYKBVTDZSA-O |
| XLogP | 4.56 |
| TPSA | 73.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|