C13H14F5N3O — CID 143079590
2-[(2Z)-2-(2,2-difluoropropoxyimino)but-3-enyl]-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 143079590) has the molecular formula C13H14F5N3O and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-[(2Z)-2-(2,2-difluoropropoxyimino)but-3-enyl]-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-[(2Z)-2-(2,2-difluoropropoxyimino)but-3-enyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 143079590 |
| Molecular Formula | C13H14F5N3O |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[(2Z)-2-(2,2-difluoropropoxyimino)but-3-enyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | C=C/C(CC(C#N)(C#N)CCC(F)(F)F)=N\OCC(C)(F)F |
| InChI | InChI=1S/C13H14F5N3O/c1-3-10(21-22-9-11(2,14)15)6-12(7-19,8-20)4-5-13(16,17)18/h3H,1,4-6,9H2,2H3/b21-10+ |
| InChIKey | XZFBLWVTDIITTJ-UFFVCSGVSA-N |
| XLogP | 3.97 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|