About 3,4-diethoxyoxolane
3,4-diethoxyoxolane (PubChem CID 14307969) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 3,4-diethoxyoxolane.
Molecular Properties
| Compound Name | 3,4-diethoxyoxolane |
| PubChem CID | 14307969 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 3,4-diethoxyoxolane |
| SMILES | CCOC1COCC1OCC |
| InChI | InChI=1S/C8H16O3/c1-3-10-7-5-9-6-8(7)11-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZADPQAVDVYPQTB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-diethoxyoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethoxyoxolane?
The IUPAC name of 3,4-diethoxyoxolane (CID 14307969) is 3,4-diethoxyoxolane.
What is the SMILES notation for 3,4-diethoxyoxolane?
The canonical SMILES for 3,4-diethoxyoxolane is CCOC1COCC1OCC.
What is the InChIKey of 3,4-diethoxyoxolane?
The InChIKey is ZADPQAVDVYPQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-3-10-7-5-9-6-8(7)11-4-2/h7-8H,3-6H2,1-2H3.
What are the key properties of 3,4-diethoxyoxolane?
3,4-diethoxyoxolane has a molecular weight of 160.21 g/mol, XLogP of 0.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethoxyoxolane is sourced from PubChem (CID 14307969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).