C20H38N2O4 — CID 143079825
3-[5-[2-(3,3-dimethylbutoxy)ethoxy]-3,3-dimethylpentyl]-1-ethylimidazolidine-2,4-dione (PubChem CID 143079825) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is 3-[5-[2-(3,3-dimethylbutoxy)ethoxy]-3,3-dimethylpentyl]-1-ethylimidazolidine-2,4-dione.
| Compound Name | 3-[5-[2-(3,3-dimethylbutoxy)ethoxy]-3,3-dimethylpentyl]-1-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143079825 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 3-[5-[2-(3,3-dimethylbutoxy)ethoxy]-3,3-dimethylpentyl]-1-ethylimidazolidine-2,4-dione |
| SMILES | CCN1CC(=O)N(CCC(C)(C)CCOCCOCCC(C)(C)C)C1=O |
| InChI | InChI=1S/C20H38N2O4/c1-7-21-16-17(23)22(18(21)24)11-8-20(5,6)10-13-26-15-14-25-12-9-19(2,3)4/h7-16H2,1-6H3 |
| InChIKey | BKSCWSHRSMQGFE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|