C16H20O4 — CID 14307985
(3aS,6S,7aR)-2,2-dimethyl-7-methylidene-6-phenylmethoxy-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 14307985) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3aS,6S,7aR)-2,2-dimethyl-7-methylidene-6-phenylmethoxy-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aS,6S,7aR)-2,2-dimethyl-7-methylidene-6-phenylmethoxy-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 14307985 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3aS,6S,7aR)-2,2-dimethyl-7-methylidene-6-phenylmethoxy-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | C=C1[C@@H](OCc2ccccc2)OC[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H20O4/c1-11-14-13(19-16(2,3)20-14)10-18-15(11)17-9-12-7-5-4-6-8-12/h4-8,13-15H,1,9-10H2,2-3H3/t13-,14+,15-/m0/s1 |
| InChIKey | RDWMRYQOIRFOLV-ZNMIVQPWSA-N |
| XLogP | 2.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|