C16H26O — CID 143079929
4,4-dimethylhexan-2-one;ethylbenzene (PubChem CID 143079929) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 4,4-dimethylhexan-2-one;ethylbenzene.
| Compound Name | 4,4-dimethylhexan-2-one;ethylbenzene |
|---|---|
| PubChem CID | 143079929 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 4,4-dimethylhexan-2-one;ethylbenzene |
| SMILES | CCC(C)(C)CC(C)=O.CCc1ccccc1 |
| InChI | InChI=1S/C8H16O.C8H10/c1-5-8(3,4)6-7(2)9;1-2-8-6-4-3-5-7-8/h5-6H2,1-4H3;3-7H,2H2,1H3 |
| InChIKey | PQMGGDHFRZRHFA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |