C20H36ClN9O3 — CID 143080105
3,5-diamino-6-chloro-N-[N'-[4-[4-(3-hydroxypropanoylamino)butan-2-yl-methylamino]-4-methylpentyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 143080105) has the molecular formula C20H36ClN9O3 and a molecular weight of 486.02 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-(3-hydroxypropanoylamino)butan-2-yl-methylamino]-4-methylpentyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-(3-hydroxypropanoylamino)butan-2-yl-methylamino]-4-methylpentyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143080105 |
| Molecular Formula | C20H36ClN9O3 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-(3-hydroxypropanoylamino)butan-2-yl-methylamino]-4-methylpentyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC(CCNC(=O)CCO)N(C)C(C)(C)CCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C20H36ClN9O3/c1-12(6-10-25-13(32)7-11-31)30(4)20(2,3)8-5-9-26-19(24)29-18(33)14-16(22)28-17(23)15(21)27-14/h12,31H,5-11H2,1-4H3,(H,25,32)(H4,22,23,28)(H3,24,26,29,33) |
| InChIKey | FFTQLKDCUFJMQK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|