About (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane
(Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane (PubChem CID 143080229) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane.
Molecular Properties
| Compound Name | (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane |
| PubChem CID | 143080229 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane |
| SMILES | CC1CC1.CCO/C(=C\C(C)C)CN |
| InChI | InChI=1S/C8H17NO.C4H8/c1-4-10-8(6-9)5-7(2)3;1-4-2-3-4/h5,7H,4,6,9H2,1-3H3;4H,2-3H2,1H3/b8-5-; |
| InChIKey | BVTPHCZKNIZGGS-HGKIGUAWSA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane?
The IUPAC name of (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane (CID 143080229) is (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane.
What is the SMILES notation for (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane?
The canonical SMILES for (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane is CC1CC1.CCO/C(=C\C(C)C)CN.
What is the InChIKey of (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane?
The InChIKey is BVTPHCZKNIZGGS-HGKIGUAWSA-N. The full InChI is InChI=1S/C8H17NO.C4H8/c1-4-10-8(6-9)5-7(2)3;1-4-2-3-4/h5,7H,4,6,9H2,1-3H3;4H,2-3H2,1H3/b8-5-;.
What are the key properties of (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane?
(Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane has a molecular weight of 199.34 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-ethoxy-4-methylpent-2-en-1-amine;methylcyclopropane is sourced from PubChem (CID 143080229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).