About (Z)-3-methoxy-5,6-dimethylhept-3-ene
(Z)-3-methoxy-5,6-dimethylhept-3-ene (PubChem CID 143080239) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is (Z)-3-methoxy-5,6-dimethylhept-3-ene.
Molecular Properties
| Compound Name | (Z)-3-methoxy-5,6-dimethylhept-3-ene |
| PubChem CID | 143080239 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (Z)-3-methoxy-5,6-dimethylhept-3-ene |
| SMILES | CC/C(=C/C(C)C(C)C)OC |
| InChI | InChI=1S/C10H20O/c1-6-10(11-5)7-9(4)8(2)3/h7-9H,6H2,1-5H3/b10-7- |
| InChIKey | AJLLEWIJIXIZPU-YFHOEESVSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methoxy-5,6-dimethylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methoxy-5,6-dimethylhept-3-ene?
The IUPAC name of (Z)-3-methoxy-5,6-dimethylhept-3-ene (CID 143080239) is (Z)-3-methoxy-5,6-dimethylhept-3-ene.
What is the SMILES notation for (Z)-3-methoxy-5,6-dimethylhept-3-ene?
The canonical SMILES for (Z)-3-methoxy-5,6-dimethylhept-3-ene is CC/C(=C/C(C)C(C)C)OC.
What is the InChIKey of (Z)-3-methoxy-5,6-dimethylhept-3-ene?
The InChIKey is AJLLEWIJIXIZPU-YFHOEESVSA-N. The full InChI is InChI=1S/C10H20O/c1-6-10(11-5)7-9(4)8(2)3/h7-9H,6H2,1-5H3/b10-7-.
What are the key properties of (Z)-3-methoxy-5,6-dimethylhept-3-ene?
(Z)-3-methoxy-5,6-dimethylhept-3-ene has a molecular weight of 156.27 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methoxy-5,6-dimethylhept-3-ene is sourced from PubChem (CID 143080239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).