About (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol
(5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol (PubChem CID 143080299) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol.
Molecular Properties
| Compound Name | (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol |
| PubChem CID | 143080299 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol |
| SMILES | C=C/C=C(\OCCC)C(O)CC(C)(C)C |
| InChI | InChI=1S/C13H24O2/c1-6-8-12(15-9-7-2)11(14)10-13(3,4)5/h6,8,11,14H,1,7,9-10H2,2-5H3/b12-8- |
| InChIKey | QLNIQBOMSILULL-WQLSENKSSA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol?
The IUPAC name of (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol (CID 143080299) is (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol.
What is the SMILES notation for (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol?
The canonical SMILES for (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol is C=C/C=C(\OCCC)C(O)CC(C)(C)C.
What is the InChIKey of (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol?
The InChIKey is QLNIQBOMSILULL-WQLSENKSSA-N. The full InChI is InChI=1S/C13H24O2/c1-6-8-12(15-9-7-2)11(14)10-13(3,4)5/h6,8,11,14H,1,7,9-10H2,2-5H3/b12-8-.
What are the key properties of (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol?
(5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol has a molecular weight of 212.33 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2,2-dimethyl-5-propoxyocta-5,7-dien-4-ol is sourced from PubChem (CID 143080299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).