About acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane
acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane (PubChem CID 143080478) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane.
Molecular Properties
| Compound Name | acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane |
| PubChem CID | 143080478 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane |
| SMILES | C#C.CC/C=C(/CN)OCC.CC1CC1 |
| InChI | InChI=1S/C7H15NO.C4H8.C2H2/c1-3-5-7(6-8)9-4-2;1-4-2-3-4;1-2/h5H,3-4,6,8H2,1-2H3;4H,2-3H2,1H3;1-2H/b7-5-;; |
| InChIKey | DFWNRJYSANOTOJ-MWKZNRQPSA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane?
The IUPAC name of acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane (CID 143080478) is acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane.
What is the SMILES notation for acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane?
The canonical SMILES for acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane is C#C.CC/C=C(/CN)OCC.CC1CC1.
What is the InChIKey of acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane?
The InChIKey is DFWNRJYSANOTOJ-MWKZNRQPSA-N. The full InChI is InChI=1S/C7H15NO.C4H8.C2H2/c1-3-5-7(6-8)9-4-2;1-4-2-3-4;1-2/h5H,3-4,6,8H2,1-2H3;4H,2-3H2,1H3;1-2H/b7-5-;;.
What are the key properties of acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane?
acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane has a molecular weight of 211.35 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(Z)-2-ethoxypent-2-en-1-amine;methylcyclopropane is sourced from PubChem (CID 143080478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).