About ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one
ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one (PubChem CID 143080732) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one.
Molecular Properties
| Compound Name | ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one |
| PubChem CID | 143080732 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one |
| SMILES | C=C/C=c1/oc(=O)cc(O)/c1=C/C.CC |
| InChI | InChI=1S/C10H10O3.C2H6/c1-3-5-9-7(4-2)8(11)6-10(12)13-9;1-2/h3-6,11H,1H2,2H3;1-2H3/b7-4-,9-5+; |
| InChIKey | UXCPMTFCXVJZPJ-GXTWMUOHSA-N |
| XLogP | 1.14 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one?
The IUPAC name of ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one (CID 143080732) is ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one.
What is the SMILES notation for ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one?
The canonical SMILES for ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one is C=C/C=c1/oc(=O)cc(O)/c1=C/C.CC.
What is the InChIKey of ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one?
The InChIKey is UXCPMTFCXVJZPJ-GXTWMUOHSA-N. The full InChI is InChI=1S/C10H10O3.C2H6/c1-3-5-9-7(4-2)8(11)6-10(12)13-9;1-2/h3-6,11H,1H2,2H3;1-2H3/b7-4-,9-5+;.
What are the key properties of ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one?
ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one has a molecular weight of 208.26 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5Z,6E)-5-ethylidene-4-hydroxy-6-prop-2-enylidenepyran-2-one is sourced from PubChem (CID 143080732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).