C34H26Br2O3S2 — CID 143080756
4-[(2Z,4Z)-2-(bromomethyl)hepta-2,4,6-trienyl]sulfanyl-3-[[1-(4-bromophenyl)sulfanyl-3-oxo-4H-naphthalen-2-yl]methyl]chromen-2-one (PubChem CID 143080756) has the molecular formula C34H26Br2O3S2 and a molecular weight of 706.52 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2-(bromomethyl)hepta-2,4,6-trienyl]sulfanyl-3-[[1-(4-bromophenyl)sulfanyl-3-oxo-4H-naphthalen-2-yl]methyl]chromen-2-one.
| Compound Name | 4-[(2Z,4Z)-2-(bromomethyl)hepta-2,4,6-trienyl]sulfanyl-3-[[1-(4-bromophenyl)sulfanyl-3-oxo-4H-naphthalen-2-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 143080756 |
| Molecular Formula | C34H26Br2O3S2 |
| Molecular Weight | 706.52 g/mol |
| Exact Mass | 703.97 |
| IUPAC Name | 4-[(2Z,4Z)-2-(bromomethyl)hepta-2,4,6-trienyl]sulfanyl-3-[[1-(4-bromophenyl)sulfanyl-3-oxo-4H-naphthalen-2-yl]methyl]chromen-2-one |
| SMILES | C=C/C=C\C=C(/CBr)CSc1c(CC2=C(Sc3ccc(Br)cc3)c3ccccc3CC2=O)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C34H26Br2O3S2/c1-2-3-4-9-22(20-35)21-40-32-27-12-7-8-13-31(27)39-34(38)29(32)19-28-30(37)18-23-10-5-6-11-26(23)33(28)41-25-16-14-24(36)15-17-25/h2-17H,1,18-21H2/b4-3-,22-9+ |
| InChIKey | JCOLKXSVAACAGN-KJHWUBDXSA-N |
| XLogP | 9.58 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.52 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|