About (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol
(6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol (PubChem CID 143081094) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol.
Molecular Properties
| Compound Name | (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol |
| PubChem CID | 143081094 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol |
| SMILES | C#CC(CC)OC1C=CCC(COCO)O1 |
| InChI | InChI=1S/C12H18O4/c1-3-10(4-2)15-12-7-5-6-11(16-12)8-14-9-13/h1,5,7,10-13H,4,6,8-9H2,2H3 |
| InChIKey | BZYCUMZZYNUDDS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol?
The IUPAC name of (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol (CID 143081094) is (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol.
What is the SMILES notation for (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol?
The canonical SMILES for (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol is C#CC(CC)OC1C=CCC(COCO)O1.
What is the InChIKey of (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol?
The InChIKey is BZYCUMZZYNUDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-3-10(4-2)15-12-7-5-6-11(16-12)8-14-9-13/h1,5,7,10-13H,4,6,8-9H2,2H3.
What are the key properties of (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol?
(6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol has a molecular weight of 226.27 g/mol, XLogP of 1.05, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-pent-1-yn-3-yloxy-3,6-dihydro-2H-pyran-2-yl)methoxymethanol is sourced from PubChem (CID 143081094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).