C8H12O3 — CID 143081099
(4aR,8aS)-6-methyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine (PubChem CID 143081099) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (4aR,8aS)-6-methyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,8aS)-6-methyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 143081099 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (4aR,8aS)-6-methyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CC1C=C[C@@H]2OCOC[C@H]2O1 |
| InChI | InChI=1S/C8H12O3/c1-6-2-3-7-8(11-6)4-9-5-10-7/h2-3,6-8H,4-5H2,1H3/t6?,7-,8+/m0/s1 |
| InChIKey | OPOPLLOISIGQGB-ZHFSPANRSA-N |
| XLogP | 0.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|