About formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate
formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate (PubChem CID 143081134) has the molecular formula C16H26N2O4
and a molecular weight of 310.39 g/mol. Its IUPAC name is formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate.
Molecular Properties
| Compound Name | formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate |
| PubChem CID | 143081134 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate |
| SMILES | C=CCCCCCCC(=O)N1CC(OC(=O)C=C)C1.NC=O |
| InChI | InChI=1S/C15H23NO3.CH3NO/c1-3-5-6-7-8-9-10-14(17)16-11-13(12-16)19-15(18)4-2;2-1-3/h3-4,13H,1-2,5-12H2;1H,(H2,2,3) |
| InChIKey | DLPLOEUUAXMVIC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate?
The IUPAC name of formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate (CID 143081134) is formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate.
What is the SMILES notation for formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate?
The canonical SMILES for formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate is C=CCCCCCCC(=O)N1CC(OC(=O)C=C)C1.NC=O.
What is the InChIKey of formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate?
The InChIKey is DLPLOEUUAXMVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3.CH3NO/c1-3-5-6-7-8-9-10-14(17)16-11-13(12-16)19-15(18)4-2;2-1-3/h3-4,13H,1-2,5-12H2;1H,(H2,2,3).
What are the key properties of formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate?
formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate has a molecular weight of 310.39 g/mol, XLogP of 1.55, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;(1-non-8-enoylazetidin-3-yl) prop-2-enoate is sourced from PubChem (CID 143081134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).