About ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene
ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene (PubChem CID 143082438) has the molecular formula C18H31NS
and a molecular weight of 293.52 g/mol. Its IUPAC name is ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene.
Molecular Properties
| Compound Name | ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene |
| PubChem CID | 143082438 |
| Molecular Formula | C18H31NS |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene |
| SMILES | C=CC.C=Cc1[nH]c(C)cc(=S)c1/C=C\C.CC.CC |
| InChI | InChI=1S/C11H13NS.C3H6.2C2H6/c1-4-6-9-10(5-2)12-8(3)7-11(9)13;1-3-2;2*1-2/h4-7H,2H2,1,3H3,(H,12,13);3H,1H2,2H3;2*1-2H3/b6-4-;;; |
| InChIKey | NKEAOVNLOUZGEG-UVOCCRBZSA-N |
| XLogP | 6.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene?
The IUPAC name of ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene (CID 143082438) is ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene.
What is the SMILES notation for ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene?
The canonical SMILES for ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene is C=CC.C=Cc1[nH]c(C)cc(=S)c1/C=C\C.CC.CC.
What is the InChIKey of ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene?
The InChIKey is NKEAOVNLOUZGEG-UVOCCRBZSA-N. The full InChI is InChI=1S/C11H13NS.C3H6.2C2H6/c1-4-6-9-10(5-2)12-8(3)7-11(9)13;1-3-2;2*1-2/h4-7H,2H2,1,3H3,(H,12,13);3H,1H2,2H3;2*1-2H3/b6-4-;;;.
What are the key properties of ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene?
ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene has a molecular weight of 293.52 g/mol, XLogP of 6.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethenyl-6-methyl-3-[(Z)-prop-1-enyl]-1H-pyridine-4-thione;prop-1-ene is sourced from PubChem (CID 143082438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).