About (4-fluorophenyl) N-methylethanimidothioate
(4-fluorophenyl) N-methylethanimidothioate (PubChem CID 143082602) has the molecular formula C9H10FNS
and a molecular weight of 183.25 g/mol. Its IUPAC name is (4-fluorophenyl) N-methylethanimidothioate.
Molecular Properties
| Compound Name | (4-fluorophenyl) N-methylethanimidothioate |
| PubChem CID | 143082602 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (4-fluorophenyl) N-methylethanimidothioate |
| SMILES | C/N=C(\C)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C9H10FNS/c1-7(11-2)12-9-5-3-8(10)4-6-9/h3-6H,1-2H3/b11-7+ |
| InChIKey | OXUTUZHZDMCVQF-YRNVUSSQSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl) N-methylethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) N-methylethanimidothioate?
The IUPAC name of (4-fluorophenyl) N-methylethanimidothioate (CID 143082602) is (4-fluorophenyl) N-methylethanimidothioate.
What is the SMILES notation for (4-fluorophenyl) N-methylethanimidothioate?
The canonical SMILES for (4-fluorophenyl) N-methylethanimidothioate is C/N=C(\C)Sc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl) N-methylethanimidothioate?
The InChIKey is OXUTUZHZDMCVQF-YRNVUSSQSA-N. The full InChI is InChI=1S/C9H10FNS/c1-7(11-2)12-9-5-3-8(10)4-6-9/h3-6H,1-2H3/b11-7+.
What are the key properties of (4-fluorophenyl) N-methylethanimidothioate?
(4-fluorophenyl) N-methylethanimidothioate has a molecular weight of 183.25 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) N-methylethanimidothioate is sourced from PubChem (CID 143082602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).