C10H16OS — CID 143082910
ethane;2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran (PubChem CID 143082910) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is ethane;2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran.
| Compound Name | ethane;2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran |
|---|---|
| PubChem CID | 143082910 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | ethane;2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran |
| SMILES | C1=C2CCCOC2=CSC1.CC |
| InChI | InChI=1S/C8H10OS.C2H6/c1-2-7-3-5-10-6-8(7)9-4-1;1-2/h3,6H,1-2,4-5H2;1-2H3 |
| InChIKey | LORKUZQACQSSLS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |