C8H10OS — CID 143082911
2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran (PubChem CID 143082911) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is 2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran.
| Compound Name | 2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran |
|---|---|
| PubChem CID | 143082911 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 2,3,4,6-tetrahydrothiopyrano[3,4-b]pyran |
| SMILES | C1=C2CCCOC2=CSC1 |
| InChI | InChI=1S/C8H10OS/c1-2-7-3-5-10-6-8(7)9-4-1/h3,6H,1-2,4-5H2 |
| InChIKey | XYHUGGAOLACPSP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |