C15H22O3P2 — CID 143082940
3-[(2R,5R)-2,5-dimethylphospholan-1-yl]-4-[(2R)-2-methylphospholan-1-yl]furan-2,5-dione (PubChem CID 143082940) has the molecular formula C15H22O3P2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-[(2R,5R)-2,5-dimethylphospholan-1-yl]-4-[(2R)-2-methylphospholan-1-yl]furan-2,5-dione.
| Compound Name | 3-[(2R,5R)-2,5-dimethylphospholan-1-yl]-4-[(2R)-2-methylphospholan-1-yl]furan-2,5-dione |
|---|---|
| PubChem CID | 143082940 |
| Molecular Formula | C15H22O3P2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-[(2R,5R)-2,5-dimethylphospholan-1-yl]-4-[(2R)-2-methylphospholan-1-yl]furan-2,5-dione |
| SMILES | C[C@@H]1CCCP1C1=C(P2[C@H](C)CC[C@H]2C)C(=O)OC1=O |
| InChI | InChI=1S/C15H22O3P2/c1-9-5-4-8-19(9)12-13(15(17)18-14(12)16)20-10(2)6-7-11(20)3/h9-11H,4-8H2,1-3H3/t9-,10-,11-,19?/m1/s1 |
| InChIKey | UFZWKNKLMFGTNN-MJVWDSAISA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|