C18H31N — CID 143083252
1-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-3-yl]-4-methylcyclohexan-1-amine (PubChem CID 143083252) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-3-yl]-4-methylcyclohexan-1-amine.
| Compound Name | 1-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-3-yl]-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 143083252 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 1-[(2E,4E)-5-tert-butylhepta-2,4,6-trien-3-yl]-4-methylcyclohexan-1-amine |
| SMILES | C=C/C(=C\C(=C/C)C1(N)CCC(C)CC1)C(C)(C)C |
| InChI | InChI=1S/C18H31N/c1-7-15(17(4,5)6)13-16(8-2)18(19)11-9-14(3)10-12-18/h7-8,13-14H,1,9-12,19H2,2-6H3/b15-13+,16-8+ |
| InChIKey | IBJQEHXQCQMGQF-DHZDYVSMSA-N |
| XLogP | 5.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|