C22H20Br2O5 — CID 143083323
2',7'-dibromo-3',6'-dimethoxyspiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 143083323) has the molecular formula C22H20Br2O5 and a molecular weight of 524.21 g/mol. Its IUPAC name is 2',7'-dibromo-3',6'-dimethoxyspiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2',7'-dibromo-3',6'-dimethoxyspiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 143083323 |
| Molecular Formula | C22H20Br2O5 |
| Molecular Weight | 524.21 g/mol |
| Exact Mass | 521.97 |
| IUPAC Name | 2',7'-dibromo-3',6'-dimethoxyspiro[3a,4,5,6,7,7a-hexahydro-2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | COc1cc2c(cc1Br)C1(OC(=O)C3CCCCC31)c1cc(Br)c(OC)cc1O2 |
| InChI | InChI=1S/C22H20Br2O5/c1-26-19-9-17-13(7-15(19)23)22(12-6-4-3-5-11(12)21(25)29-22)14-8-16(24)20(27-2)10-18(14)28-17/h7-12H,3-6H2,1-2H3 |
| InChIKey | WMPFVFXIFZCRLR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.21 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |