C21H19N3O3 — CID 143083772
4-[5-(cyclopropylmethylcarbamoyl)naphthalen-2-yl]oxypyridine-2-carboxamide (PubChem CID 143083772) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 4-[5-(cyclopropylmethylcarbamoyl)naphthalen-2-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[5-(cyclopropylmethylcarbamoyl)naphthalen-2-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 143083772 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4-[5-(cyclopropylmethylcarbamoyl)naphthalen-2-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(Oc2ccc3c(C(=O)NCC4CC4)cccc3c2)ccn1 |
| InChI | InChI=1S/C21H19N3O3/c22-20(25)19-11-16(8-9-23-19)27-15-6-7-17-14(10-15)2-1-3-18(17)21(26)24-12-13-4-5-13/h1-3,6-11,13H,4-5,12H2,(H2,22,25)(H,24,26) |
| InChIKey | IJTQVWHTPYHHBD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |