About 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide
4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide (PubChem CID 143084224) has the molecular formula C22H27N5O2S
and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide |
| PubChem CID | 143084224 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCN2CCOCC2)cc1.Nc1nc(C2=CN=CCC=C2)cs1 |
| InChI | InChI=1S/C13H18N2O2.C9H9N3S/c1-11-2-4-12(5-3-11)13(16)14-10-15-6-8-17-9-7-15;10-9-12-8(6-13-9)7-3-1-2-4-11-5-7/h2-5H,6-10H2,1H3,(H,14,16);1,3-6H,2H2,(H2,10,12) |
| InChIKey | SUPPOTDKRYDHIJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide?
The IUPAC name of 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide (CID 143084224) is 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide.
What is the SMILES notation for 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide?
The canonical SMILES for 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide is Cc1ccc(C(=O)NCN2CCOCC2)cc1.Nc1nc(C2=CN=CCC=C2)cs1.
What is the InChIKey of 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide?
The InChIKey is SUPPOTDKRYDHIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2.C9H9N3S/c1-11-2-4-12(5-3-11)13(16)14-10-15-6-8-17-9-7-15;10-9-12-8(6-13-9)7-3-1-2-4-11-5-7/h2-5H,6-10H2,1H3,(H,14,16);1,3-6H,2H2,(H2,10,12).
What are the key properties of 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide?
4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide has a molecular weight of 425.56 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3H-azepin-6-yl)-1,3-thiazol-2-amine;4-methyl-N-(morpholin-4-ylmethyl)benzamide is sourced from PubChem (CID 143084224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).