About 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide
5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide (PubChem CID 143084368) has the molecular formula C22H23F2NO4
and a molecular weight of 403.43 g/mol. Its IUPAC name is 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide |
| PubChem CID | 143084368 |
| Molecular Formula | C22H23F2NO4 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide |
| SMILES | CCCCC(=O)c1oc2c(F)cc(F)cc2c1NC(=O)c1ccc(C(C)(C)C)o1 |
| InChI | InChI=1S/C22H23F2NO4/c1-5-6-7-15(26)20-18(13-10-12(23)11-14(24)19(13)29-20)25-21(27)16-8-9-17(28-16)22(2,3)4/h8-11H,5-7H2,1-4H3,(H,25,27) |
| InChIKey | PNVGYTTWIGMSJR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide?
The IUPAC name of 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide (CID 143084368) is 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide.
What is the SMILES notation for 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide?
The canonical SMILES for 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide is CCCCC(=O)c1oc2c(F)cc(F)cc2c1NC(=O)c1ccc(C(C)(C)C)o1.
What is the InChIKey of 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide?
The InChIKey is PNVGYTTWIGMSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2NO4/c1-5-6-7-15(26)20-18(13-10-12(23)11-14(24)19(13)29-20)25-21(27)16-8-9-17(28-16)22(2,3)4/h8-11H,5-7H2,1-4H3,(H,25,27).
What are the key properties of 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide?
5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide has a molecular weight of 403.43 g/mol, XLogP of 6.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-(5,7-difluoro-2-pentanoyl-1-benzofuran-3-yl)furan-2-carboxamide is sourced from PubChem (CID 143084368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).