About 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one
3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one (PubChem CID 143084531) has the molecular formula C24H23O4P
and a molecular weight of 406.42 g/mol. Its IUPAC name is 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one.
Molecular Properties
| Compound Name | 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one |
| PubChem CID | 143084531 |
| Molecular Formula | C24H23O4P |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one |
| SMILES | CCCC(=O)c1ccc(-c2ccccc2)o1.Cc1c(C=O)oc2cc(P)ccc12 |
| InChI | InChI=1S/C14H14O2.C10H9O2P/c1-2-6-12(15)14-10-9-13(16-14)11-7-4-3-5-8-11;1-6-8-3-2-7(13)4-9(8)12-10(6)5-11/h3-5,7-10H,2,6H2,1H3;2-5H,13H2,1H3 |
| InChIKey | KJTASVTZIAQZHU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one?
The IUPAC name of 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one (CID 143084531) is 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one.
What is the SMILES notation for 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one?
The canonical SMILES for 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one is CCCC(=O)c1ccc(-c2ccccc2)o1.Cc1c(C=O)oc2cc(P)ccc12.
What is the InChIKey of 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one?
The InChIKey is KJTASVTZIAQZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.C10H9O2P/c1-2-6-12(15)14-10-9-13(16-14)11-7-4-3-5-8-11;1-6-8-3-2-7(13)4-9(8)12-10(6)5-11/h3-5,7-10H,2,6H2,1H3;2-5H,13H2,1H3.
What are the key properties of 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one?
3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one has a molecular weight of 406.42 g/mol, XLogP of 5.98, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-phosphanyl-1-benzofuran-2-carbaldehyde;1-(5-phenylfuran-2-yl)butan-1-one is sourced from PubChem (CID 143084531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).