C11H18N2 — CID 143084618
(1Z,3E)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)penta-1,3-dien-1-amine (PubChem CID 143084618) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1Z,3E)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143084618 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1Z,3E)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)penta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C/N)C1=CCN(C)CC1 |
| InChI | InChI=1S/C11H18N2/c1-3-10(4-7-12)11-5-8-13(2)9-6-11/h3-5,7H,6,8-9,12H2,1-2H3/b7-4-,10-3+ |
| InChIKey | HUKMULKVOLPQPH-PZPRPFQRSA-N |
| XLogP | 1.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|