C33H28N6O2 — CID 143085201
N-[1-(15-amino-8-nitro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethenyl]-5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-amine (PubChem CID 143085201) has the molecular formula C33H28N6O2 and a molecular weight of 540.63 g/mol. Its IUPAC name is N-[1-(15-amino-8-nitro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethenyl]-5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-amine.
| Compound Name | N-[1-(15-amino-8-nitro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethenyl]-5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 143085201 |
| Molecular Formula | C33H28N6O2 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | N-[1-(15-amino-8-nitro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethenyl]-5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-amine |
| SMILES | C=C(Nc1ncc(Cc2ccc(-c3ccncc3)cc2)[nH]1)C1(N)CC2([N+](=O)[O-])c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C33H28N6O2/c1-21(37-31-36-19-25(38-31)18-22-10-12-23(13-11-22)24-14-16-35-17-15-24)32(34)20-33(39(40)41)28-8-4-2-6-26(28)30(32)27-7-3-5-9-29(27)33/h2-17,19,30H,1,18,20,34H2,(H2,36,37,38) |
| InChIKey | MDAHETXVOOZASQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|