About ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide
ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide (PubChem CID 143085250) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide |
| PubChem CID | 143085250 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide |
| SMILES | C/C=C\C=C/C(C)=N/C=N/C.CC |
| InChI | InChI=1S/C9H14N2.C2H6/c1-4-5-6-7-9(2)11-8-10-3;1-2/h4-8H,1-3H3;1-2H3/b5-4-,7-6-,10-8+,11-9+; |
| InChIKey | VERGVFJGHWJZEX-MAAXHVBPSA-N |
| XLogP | 3.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide?
The IUPAC name of ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide (CID 143085250) is ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide.
What is the SMILES notation for ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide?
The canonical SMILES for ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide is C/C=C\C=C/C(C)=N/C=N/C.CC.
What is the InChIKey of ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide?
The InChIKey is VERGVFJGHWJZEX-MAAXHVBPSA-N. The full InChI is InChI=1S/C9H14N2.C2H6/c1-4-5-6-7-9(2)11-8-10-3;1-2/h4-8H,1-3H3;1-2H3/b5-4-,7-6-,10-8+,11-9+;.
What are the key properties of ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide?
ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide has a molecular weight of 180.29 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]-N'-methylmethanimidamide is sourced from PubChem (CID 143085250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).