C27H20FN2O2P — CID 143085350
2-[5-(4-fluorophenyl)-1-methylindol-3-yl]-N-naphthalen-2-yl-2-phosphorosoacetamide (PubChem CID 143085350) has the molecular formula C27H20FN2O2P and a molecular weight of 454.44 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-1-methylindol-3-yl]-N-naphthalen-2-yl-2-phosphorosoacetamide.
| Compound Name | 2-[5-(4-fluorophenyl)-1-methylindol-3-yl]-N-naphthalen-2-yl-2-phosphorosoacetamide |
|---|---|
| PubChem CID | 143085350 |
| Molecular Formula | C27H20FN2O2P |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-1-methylindol-3-yl]-N-naphthalen-2-yl-2-phosphorosoacetamide |
| SMILES | Cn1cc(C(P=O)C(=O)Nc2ccc3ccccc3c2)c2cc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C27H20FN2O2P/c1-30-16-24(23-15-20(9-13-25(23)30)18-6-10-21(28)11-7-18)26(33-32)27(31)29-22-12-8-17-4-2-3-5-19(17)14-22/h2-16,26H,1H3,(H,29,31) |
| InChIKey | FTGRXRINRODLSD-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|