About 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane
2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane (PubChem CID 143085645) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane.
Molecular Properties
| Compound Name | 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane |
| PubChem CID | 143085645 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane |
| SMILES | CC.CC.Cc1ncc2nc(C)oc2n1 |
| InChI | InChI=1S/C7H7N3O.2C2H6/c1-4-8-3-6-7(9-4)11-5(2)10-6;2*1-2/h3H,1-2H3;2*1-2H3 |
| InChIKey | LBIBTIPZDLYAFE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane?
The IUPAC name of 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane (CID 143085645) is 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane.
What is the SMILES notation for 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane?
The canonical SMILES for 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane is CC.CC.Cc1ncc2nc(C)oc2n1.
What is the InChIKey of 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane?
The InChIKey is LBIBTIPZDLYAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.2C2H6/c1-4-8-3-6-7(9-4)11-5(2)10-6;2*1-2/h3H,1-2H3;2*1-2H3.
What are the key properties of 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane?
2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane has a molecular weight of 209.29 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine;ethane is sourced from PubChem (CID 143085645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).