C19H28F3N3O2 — CID 143085752
2-[(Z,4S)-4-aminohept-5-enoyl]-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-6-one;propane (PubChem CID 143085752) has the molecular formula C19H28F3N3O2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-[(Z,4S)-4-aminohept-5-enoyl]-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-6-one;propane.
| Compound Name | 2-[(Z,4S)-4-aminohept-5-enoyl]-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-6-one;propane |
|---|---|
| PubChem CID | 143085752 |
| Molecular Formula | C19H28F3N3O2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[(Z,4S)-4-aminohept-5-enoyl]-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-6-one;propane |
| SMILES | C/C=C\[C@@H](N)CCC(=O)N1CCn2c(cc(C(F)(F)F)cc2=O)C1.CCC |
| InChI | InChI=1S/C16H20F3N3O2.C3H8/c1-2-3-12(20)4-5-14(23)21-6-7-22-13(10-21)8-11(9-15(22)24)16(17,18)19;1-3-2/h2-3,8-9,12H,4-7,10,20H2,1H3;3H2,1-2H3/b3-2-;/t12-;/m1./s1 |
| InChIKey | GBKLDBHLMNAYIK-MWKXEPMXSA-N |
| XLogP | 3.31 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|