C14H27NO4S — CID 143085797
(2R)-2-amino-3-[3-(3-methoxy-2-methylbut-3-enoxy)-3-methylbutyl]sulfanylpropanoic acid (PubChem CID 143085797) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is (2R)-2-amino-3-[3-(3-methoxy-2-methylbut-3-enoxy)-3-methylbutyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[3-(3-methoxy-2-methylbut-3-enoxy)-3-methylbutyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 143085797 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (2R)-2-amino-3-[3-(3-methoxy-2-methylbut-3-enoxy)-3-methylbutyl]sulfanylpropanoic acid |
| SMILES | C=C(OC)C(C)COC(C)(C)CCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H27NO4S/c1-10(11(2)18-5)8-19-14(3,4)6-7-20-9-12(15)13(16)17/h10,12H,2,6-9,15H2,1,3-5H3,(H,16,17)/t10?,12-/m0/s1 |
| InChIKey | YNYNIJJTIUXTTI-KFJBMODSSA-N |
| XLogP | 2.11 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|