C13H15BrN2O — CID 143085891
6-bromo-2,3,4,9-tetrahydro-1H-carbazole;formamide (PubChem CID 143085891) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 6-bromo-2,3,4,9-tetrahydro-1H-carbazole;formamide.
| Compound Name | 6-bromo-2,3,4,9-tetrahydro-1H-carbazole;formamide |
|---|---|
| PubChem CID | 143085891 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 6-bromo-2,3,4,9-tetrahydro-1H-carbazole;formamide |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCCC3.NC=O |
| InChI | InChI=1S/C12H12BrN.CH3NO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;2-1-3/h5-7,14H,1-4H2;1H,(H2,2,3) |
| InChIKey | OJZAITYPPLJGMN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|