C18H25FN4O3 — CID 143086680
2-[[(1R,3S)-3-[(2-fluoro-4-nitroanilino)methyl]cyclopentyl]amino]-1-pyrrolidin-1-ylethanone (PubChem CID 143086680) has the molecular formula C18H25FN4O3 and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[[(1R,3S)-3-[(2-fluoro-4-nitroanilino)methyl]cyclopentyl]amino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[(1R,3S)-3-[(2-fluoro-4-nitroanilino)methyl]cyclopentyl]amino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 143086680 |
| Molecular Formula | C18H25FN4O3 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[[(1R,3S)-3-[(2-fluoro-4-nitroanilino)methyl]cyclopentyl]amino]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN[C@@H]1CC[C@H](CNc2ccc([N+](=O)[O-])cc2F)C1)N1CCCC1 |
| InChI | InChI=1S/C18H25FN4O3/c19-16-10-15(23(25)26)5-6-17(16)21-11-13-3-4-14(9-13)20-12-18(24)22-7-1-2-8-22/h5-6,10,13-14,20-21H,1-4,7-9,11-12H2/t13-,14+/m0/s1 |
| InChIKey | GOKHOTUTXDQKRN-UONOGXRCSA-N |
| XLogP | 2.53 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|