C15H22O2S — CID 143086780
ethane;4-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-ol (PubChem CID 143086780) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is ethane;4-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-ol.
| Compound Name | ethane;4-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 143086780 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | ethane;4-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-ol |
| SMILES | C=C/C(O)=C\C=C(/C)SC1=CC=C(O)CC1.CC |
| InChI | InChI=1S/C13H16O2S.C2H6/c1-3-11(14)5-4-10(2)16-13-8-6-12(15)7-9-13;1-2/h3-6,8,14-15H,1,7,9H2,2H3;1-2H3/b10-4+,11-5+; |
| InChIKey | SBMKRVZNTDDXIE-DVHWKNMOSA-N |
| XLogP | 5.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|