About ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline
ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline (PubChem CID 143087120) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline.
Molecular Properties
| Compound Name | ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline |
| PubChem CID | 143087120 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline |
| SMILES | C=CC1=C(CC)Cc2ccccc2N1.CC.CC |
| InChI | InChI=1S/C13H15N.2C2H6/c1-3-10-9-11-7-5-6-8-13(11)14-12(10)4-2;2*1-2/h4-8,14H,2-3,9H2,1H3;2*1-2H3 |
| InChIKey | ADPDWLWCDGRBPW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline?
The IUPAC name of ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline (CID 143087120) is ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline.
What is the SMILES notation for ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline?
The canonical SMILES for ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline is C=CC1=C(CC)Cc2ccccc2N1.CC.CC.
What is the InChIKey of ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline?
The InChIKey is ADPDWLWCDGRBPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N.2C2H6/c1-3-10-9-11-7-5-6-8-13(11)14-12(10)4-2;2*1-2/h4-8,14H,2-3,9H2,1H3;2*1-2H3.
What are the key properties of ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline?
ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline has a molecular weight of 245.41 g/mol, XLogP of 5.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethenyl-3-ethyl-1,4-dihydroquinoline is sourced from PubChem (CID 143087120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).