C32H38N2O5 — CID 143087305
prop-2-enyl (10R)-9-(4-ethoxyphenyl)-4-(2-methoxyethylcarbamoyl)-8-azapentacyclo[8.7.0.01,15.02,7.015,17]heptadeca-2(7),3,5-triene-16-carboxylate (PubChem CID 143087305) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is prop-2-enyl (10R)-9-(4-ethoxyphenyl)-4-(2-methoxyethylcarbamoyl)-8-azapentacyclo[8.7.0.01,15.02,7.015,17]heptadeca-2(7),3,5-triene-16-carboxylate.
| Compound Name | prop-2-enyl (10R)-9-(4-ethoxyphenyl)-4-(2-methoxyethylcarbamoyl)-8-azapentacyclo[8.7.0.01,15.02,7.015,17]heptadeca-2(7),3,5-triene-16-carboxylate |
|---|---|
| PubChem CID | 143087305 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | prop-2-enyl (10R)-9-(4-ethoxyphenyl)-4-(2-methoxyethylcarbamoyl)-8-azapentacyclo[8.7.0.01,15.02,7.015,17]heptadeca-2(7),3,5-triene-16-carboxylate |
| SMILES | C=CCOC(=O)C1C2C13CCCC[C@H]1C(c4ccc(OCC)cc4)Nc4ccc(C(=O)NCCOC)cc4C213 |
| InChI | InChI=1S/C32H38N2O5/c1-4-17-39-30(36)26-28-31(26)15-7-6-8-23-27(20-9-12-22(13-10-20)38-5-2)34-25-14-11-21(19-24(25)32(23,28)31)29(35)33-16-18-37-3/h4,9-14,19,23,26-28,34H,1,5-8,15-18H2,2-3H3,(H,33,35)/t23-,26?,27?,28?,31?,32?/m0/s1 |
| InChIKey | YKYGILFAWJWREA-OVGHDNGCSA-N |
| XLogP | 5.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|